C19H22FN3O2S — CID 55697446
2-[2-[3-(4-fluorophenyl)sulfanylpropylcarbamoylamino]phenyl]-N-methylacetamide (PubChem CID 55697446) has the molecular formula C19H22FN3O2S and a molecular weight of 375.47 g/mol. Its IUPAC name is 2-[2-[3-(4-fluorophenyl)sulfanylpropylcarbamoylamino]phenyl]-N-methylacetamide.
| Compound Name | 2-[2-[3-(4-fluorophenyl)sulfanylpropylcarbamoylamino]phenyl]-N-methylacetamide |
|---|---|
| PubChem CID | 55697446 |
| Molecular Formula | C19H22FN3O2S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | 2-[2-[3-(4-fluorophenyl)sulfanylpropylcarbamoylamino]phenyl]-N-methylacetamide |
| SMILES | CNC(=O)Cc1ccccc1NC(=O)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FN3O2S/c1-21-18(24)13-14-5-2-3-6-17(14)23-19(25)22-11-4-12-26-16-9-7-15(20)8-10-16/h2-3,5-10H,4,11-13H2,1H3,(H,21,24)(H2,22,23,25) |
| InChIKey | MZOJKRGSZNRCQO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|