C18H19F3N2O2S — CID 56557413
1-[2-(difluoromethoxy)-6-methylphenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea (PubChem CID 56557413) has the molecular formula C18H19F3N2O2S and a molecular weight of 384.42 g/mol. Its IUPAC name is 1-[2-(difluoromethoxy)-6-methylphenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea.
| Compound Name | 1-[2-(difluoromethoxy)-6-methylphenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea |
|---|---|
| PubChem CID | 56557413 |
| Molecular Formula | C18H19F3N2O2S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | 1-[2-(difluoromethoxy)-6-methylphenyl]-3-[3-(4-fluorophenyl)sulfanylpropyl]urea |
| SMILES | Cc1cccc(OC(F)F)c1NC(=O)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C18H19F3N2O2S/c1-12-4-2-5-15(25-17(20)21)16(12)23-18(24)22-10-3-11-26-14-8-6-13(19)7-9-14/h2,4-9,17H,3,10-11H2,1H3,(H2,22,23,24) |
| InChIKey | NUDBTCHSVYORQK-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|