C21H26FN3O2S — CID 56504949
3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(4-fluorophenyl)sulfanylpropyl]propanamide (PubChem CID 56504949) has the molecular formula C21H26FN3O2S and a molecular weight of 403.52 g/mol. Its IUPAC name is 3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(4-fluorophenyl)sulfanylpropyl]propanamide.
| Compound Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(4-fluorophenyl)sulfanylpropyl]propanamide |
|---|---|
| PubChem CID | 56504949 |
| Molecular Formula | C21H26FN3O2S |
| Molecular Weight | 403.52 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 3-[[benzyl(methyl)carbamoyl]amino]-N-[3-(4-fluorophenyl)sulfanylpropyl]propanamide |
| SMILES | CN(Cc1ccccc1)C(=O)NCCC(=O)NCCCSc1ccc(F)cc1 |
| InChI | InChI=1S/C21H26FN3O2S/c1-25(16-17-6-3-2-4-7-17)21(27)24-14-12-20(26)23-13-5-15-28-19-10-8-18(22)9-11-19/h2-4,6-11H,5,12-16H2,1H3,(H,23,26)(H,24,27) |
| InChIKey | PHFKJVPTFIKUNC-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.52 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|