C20H30N2O2 — CID 55697814
4-[3-[(2-tert-butylcyclohexyl)amino]-2-hydroxypropoxy]benzonitrile (PubChem CID 55697814) has the molecular formula C20H30N2O2 and a molecular weight of 330.47 g/mol. Its IUPAC name is 4-[3-[(2-tert-butylcyclohexyl)amino]-2-hydroxypropoxy]benzonitrile.
| Compound Name | 4-[3-[(2-tert-butylcyclohexyl)amino]-2-hydroxypropoxy]benzonitrile |
|---|---|
| PubChem CID | 55697814 |
| Molecular Formula | C20H30N2O2 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.23 |
| IUPAC Name | 4-[3-[(2-tert-butylcyclohexyl)amino]-2-hydroxypropoxy]benzonitrile |
| SMILES | CC(C)(C)C1CCCCC1NCC(O)COc1ccc(C#N)cc1 |
| InChI | InChI=1S/C20H30N2O2/c1-20(2,3)18-6-4-5-7-19(18)22-13-16(23)14-24-17-10-8-15(12-21)9-11-17/h8-11,16,18-19,22-23H,4-7,13-14H2,1-3H3 |
| InChIKey | ABKJTAOFKMPXTF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 65.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |