C23H21BrN2O5 — CID 55698044
2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate (PubChem CID 55698044) has the molecular formula C23H21BrN2O5 and a molecular weight of 485.33 g/mol. Its IUPAC name is 2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate.
| Compound Name | 2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
|---|---|
| PubChem CID | 55698044 |
| Molecular Formula | C23H21BrN2O5 |
| Molecular Weight | 485.33 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | 2-(5-bromo-1-benzofuran-2-yl)ethyl 2-(4-ethyl-2,5-dioxo-4-phenylimidazolidin-1-yl)acetate |
| SMILES | CCC1(c2ccccc2)NC(=O)N(CC(=O)OCCc2cc3cc(Br)ccc3o2)C1=O |
| InChI | InChI=1S/C23H21BrN2O5/c1-2-23(16-6-4-3-5-7-16)21(28)26(22(29)25-23)14-20(27)30-11-10-18-13-15-12-17(24)8-9-19(15)31-18/h3-9,12-13H,2,10-11,14H2,1H3,(H,25,29) |
| InChIKey | DNYFZGGHHLMXRX-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.33 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|