C23H23N5O3 — CID 55700555
N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide (PubChem CID 55700555) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide.
| Compound Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide |
|---|---|
| PubChem CID | 55700555 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | N-[2-(5-methyl-1,2,4-oxadiazol-3-yl)phenyl]-4-oxo-3-pentylphthalazine-1-carboxamide |
| SMILES | CCCCCn1nc(C(=O)Nc2ccccc2-c2noc(C)n2)c2ccccc2c1=O |
| InChI | InChI=1S/C23H23N5O3/c1-3-4-9-14-28-23(30)17-11-6-5-10-16(17)20(26-28)22(29)25-19-13-8-7-12-18(19)21-24-15(2)31-27-21/h5-8,10-13H,3-4,9,14H2,1-2H3,(H,25,29) |
| InChIKey | ISBBBUXCUFQXMC-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|