C22H28N4O3 — CID 55702168
N-[4-(dimethylamino)-2-methylphenyl]-4-(3-methoxybenzoyl)piperazine-1-carboxamide (PubChem CID 55702168) has the molecular formula C22H28N4O3 and a molecular weight of 396.49 g/mol. Its IUPAC name is N-[4-(dimethylamino)-2-methylphenyl]-4-(3-methoxybenzoyl)piperazine-1-carboxamide.
| Compound Name | N-[4-(dimethylamino)-2-methylphenyl]-4-(3-methoxybenzoyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55702168 |
| Molecular Formula | C22H28N4O3 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.22 |
| IUPAC Name | N-[4-(dimethylamino)-2-methylphenyl]-4-(3-methoxybenzoyl)piperazine-1-carboxamide |
| SMILES | COc1cccc(C(=O)N2CCN(C(=O)Nc3ccc(N(C)C)cc3C)CC2)c1 |
| InChI | InChI=1S/C22H28N4O3/c1-16-14-18(24(2)3)8-9-20(16)23-22(28)26-12-10-25(11-13-26)21(27)17-6-5-7-19(15-17)29-4/h5-9,14-15H,10-13H2,1-4H3,(H,23,28) |
| InChIKey | DZOMLXLNHXZYHW-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|