C19H15N3O4S — CID 55704480
5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-2-thiophen-2-yl-1,3-oxazole-4-carbohydrazide (PubChem CID 55704480) has the molecular formula C19H15N3O4S and a molecular weight of 381.41 g/mol. Its IUPAC name is 5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-2-thiophen-2-yl-1,3-oxazole-4-carbohydrazide.
| Compound Name | 5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-2-thiophen-2-yl-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 55704480 |
| Molecular Formula | C19H15N3O4S |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 5-methyl-N'-(3-methyl-1-benzofuran-2-carbonyl)-2-thiophen-2-yl-1,3-oxazole-4-carbohydrazide |
| SMILES | Cc1oc(-c2cccs2)nc1C(=O)NNC(=O)c1oc2ccccc2c1C |
| InChI | InChI=1S/C19H15N3O4S/c1-10-12-6-3-4-7-13(12)26-16(10)18(24)22-21-17(23)15-11(2)25-19(20-15)14-8-5-9-27-14/h3-9H,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | GBPFMKRQWIJCBU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 97.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|