C19H18N4O5S — CID 9297274
N-[2-[[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 9297274) has the molecular formula C19H18N4O5S and a molecular weight of 414.44 g/mol. Its IUPAC name is N-[2-[[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | N-[2-[[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 9297274 |
| Molecular Formula | C19H18N4O5S |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[2-[[2-[2-(3-methyl-1-benzofuran-2-carbonyl)hydrazinyl]-2-oxoethyl]amino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NNC(=O)CNC(=O)CNC(=O)c2cccs2)oc2ccccc12 |
| InChI | InChI=1S/C19H18N4O5S/c1-11-12-5-2-3-6-13(12)28-17(11)19(27)23-22-16(25)10-20-15(24)9-21-18(26)14-7-4-8-29-14/h2-8H,9-10H2,1H3,(H,20,24)(H,21,26)(H,22,25)(H,23,27) |
| InChIKey | QDFJWFMNVNJGAF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 129.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|