C20H19ClN4O5S — CID 55711477
ethyl 1-[3-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]phenyl]pyrazole-3-carboxylate (PubChem CID 55711477) has the molecular formula C20H19ClN4O5S and a molecular weight of 462.92 g/mol. Its IUPAC name is ethyl 1-[3-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]phenyl]pyrazole-3-carboxylate.
| Compound Name | ethyl 1-[3-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]phenyl]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 55711477 |
| Molecular Formula | C20H19ClN4O5S |
| Molecular Weight | 462.92 g/mol |
| Exact Mass | 462.08 |
| IUPAC Name | ethyl 1-[3-[[2-chloro-5-(methylsulfamoyl)benzoyl]amino]phenyl]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)c1ccn(-c2cccc(NC(=O)c3cc(S(=O)(=O)NC)ccc3Cl)c2)n1 |
| InChI | InChI=1S/C20H19ClN4O5S/c1-3-30-20(27)18-9-10-25(24-18)14-6-4-5-13(11-14)23-19(26)16-12-15(7-8-17(16)21)31(28,29)22-2/h4-12,22H,3H2,1-2H3,(H,23,26) |
| InChIKey | RDVSXSLOEPKSCV-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.92 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |