C22H22F2N2O4 — CID 55711543
N-[3-[3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoylamino]-4-methylphenyl]cyclopropanecarboxamide (PubChem CID 55711543) has the molecular formula C22H22F2N2O4 and a molecular weight of 416.42 g/mol. Its IUPAC name is N-[3-[3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoylamino]-4-methylphenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoylamino]-4-methylphenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 55711543 |
| Molecular Formula | C22H22F2N2O4 |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | N-[3-[3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enoylamino]-4-methylphenyl]cyclopropanecarboxamide |
| SMILES | COc1cc(C=CC(=O)Nc2cc(NC(=O)C3CC3)ccc2C)ccc1OC(F)F |
| InChI | InChI=1S/C22H22F2N2O4/c1-13-3-8-16(25-21(28)15-6-7-15)12-17(13)26-20(27)10-5-14-4-9-18(30-22(23)24)19(11-14)29-2/h3-5,8-12,15,22H,6-7H2,1-2H3,(H,25,28)(H,26,27) |
| InChIKey | WLGAMYIIWUEACT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|