C19H30N2O5 — CID 55713256
N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(oxolan-2-ylmethoxy)propanamide (PubChem CID 55713256) has the molecular formula C19H30N2O5 and a molecular weight of 366.46 g/mol. Its IUPAC name is N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 55713256 |
| Molecular Formula | C19H30N2O5 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.22 |
| IUPAC Name | N-[2-(5-methylfuran-2-yl)-2-morpholin-4-ylethyl]-3-(oxolan-2-ylmethoxy)propanamide |
| SMILES | Cc1ccc(C(CNC(=O)CCOCC2CCCO2)N2CCOCC2)o1 |
| InChI | InChI=1S/C19H30N2O5/c1-15-4-5-18(26-15)17(21-7-11-23-12-8-21)13-20-19(22)6-10-24-14-16-3-2-9-25-16/h4-5,16-17H,2-3,6-14H2,1H3,(H,20,22) |
| InChIKey | MUOAQHWJUFGNJJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 73.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|