C23H30N2O5S — CID 55713686
N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 55713686) has the molecular formula C23H30N2O5S and a molecular weight of 446.57 g/mol. Its IUPAC name is N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55713686 |
| Molecular Formula | C23H30N2O5S |
| Molecular Weight | 446.57 g/mol |
| Exact Mass | 446.19 |
| IUPAC Name | N-[[3-methoxy-4-(3-methylbutoxy)phenyl]methyl]-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NCc2ccc(OCCC(C)C)c(OC)c2)cc1 |
| InChI | InChI=1S/C23H30N2O5S/c1-5-13-25-31(27,28)20-9-7-19(8-10-20)23(26)24-16-18-6-11-21(22(15-18)29-4)30-14-12-17(2)3/h5-11,15,17,25H,1,12-14,16H2,2-4H3,(H,24,26) |
| InChIKey | YFQYXKMJRUSFSO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|