C22H28N2O5S — CID 27259975
N-[2-(3,4-diethoxyphenyl)ethyl]-4-(prop-2-enylsulfamoyl)benzamide (PubChem CID 27259975) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-(prop-2-enylsulfamoyl)benzamide.
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(prop-2-enylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27259975 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-(prop-2-enylsulfamoyl)benzamide |
| SMILES | C=CCNS(=O)(=O)c1ccc(C(=O)NCCc2ccc(OCC)c(OCC)c2)cc1 |
| InChI | InChI=1S/C22H28N2O5S/c1-4-14-24-30(26,27)19-10-8-18(9-11-19)22(25)23-15-13-17-7-12-20(28-5-2)21(16-17)29-6-3/h4,7-12,16,24H,1,5-6,13-15H2,2-3H3,(H,23,25) |
| InChIKey | SSKHRZDDOOYUGB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|