C20H16BrFN2O4 — CID 55713973
4-bromo-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3,5-dimethoxybenzamide (PubChem CID 55713973) has the molecular formula C20H16BrFN2O4 and a molecular weight of 447.26 g/mol. Its IUPAC name is 4-bromo-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3,5-dimethoxybenzamide.
| Compound Name | 4-bromo-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 55713973 |
| Molecular Formula | C20H16BrFN2O4 |
| Molecular Weight | 447.26 g/mol |
| Exact Mass | 446.03 |
| IUPAC Name | 4-bromo-N-[6-(4-fluorophenoxy)-3-pyridinyl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(Oc3ccc(F)cc3)nc2)cc(OC)c1Br |
| InChI | InChI=1S/C20H16BrFN2O4/c1-26-16-9-12(10-17(27-2)19(16)21)20(25)24-14-5-8-18(23-11-14)28-15-6-3-13(22)4-7-15/h3-11H,1-2H3,(H,24,25) |
| InChIKey | BVPWSXYREMSBTF-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.26 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |