C25H33N3O3S — CID 55714266
(E)-3-[4-(ethylsulfamoyl)phenyl]-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]prop-2-enamide (PubChem CID 55714266) has the molecular formula C25H33N3O3S and a molecular weight of 455.62 g/mol. Its IUPAC name is (E)-3-[4-(ethylsulfamoyl)phenyl]-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(ethylsulfamoyl)phenyl]-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 55714266 |
| Molecular Formula | C25H33N3O3S |
| Molecular Weight | 455.62 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | (E)-3-[4-(ethylsulfamoyl)phenyl]-N-[[2-[(3-methylpiperidin-1-yl)methyl]phenyl]methyl]prop-2-enamide |
| SMILES | CCNS(=O)(=O)c1ccc(/C=C/C(=O)NCc2ccccc2CN2CCCC(C)C2)cc1 |
| InChI | InChI=1S/C25H33N3O3S/c1-3-27-32(30,31)24-13-10-21(11-14-24)12-15-25(29)26-17-22-8-4-5-9-23(22)19-28-16-6-7-20(2)18-28/h4-5,8-15,20,27H,3,6-7,16-19H2,1-2H3,(H,26,29)/b15-12+ |
| InChIKey | RUZDQZWQRZPPDN-NTCAYCPXSA-N |
| XLogP | 3.55 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.62 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|