C18H23FN2OS — CID 55715502
4-fluoro-3-methyl-N-[2-(3-methylpiperidin-1-yl)ethyl]-1-benzothiophene-2-carboxamide (PubChem CID 55715502) has the molecular formula C18H23FN2OS and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-fluoro-3-methyl-N-[2-(3-methylpiperidin-1-yl)ethyl]-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-3-methyl-N-[2-(3-methylpiperidin-1-yl)ethyl]-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 55715502 |
| Molecular Formula | C18H23FN2OS |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 4-fluoro-3-methyl-N-[2-(3-methylpiperidin-1-yl)ethyl]-1-benzothiophene-2-carboxamide |
| SMILES | Cc1c(C(=O)NCCN2CCCC(C)C2)sc2cccc(F)c12 |
| InChI | InChI=1S/C18H23FN2OS/c1-12-5-4-9-21(11-12)10-8-20-18(22)17-13(2)16-14(19)6-3-7-15(16)23-17/h3,6-7,12H,4-5,8-11H2,1-2H3,(H,20,22) |
| InChIKey | ARAQMHDBSLMTQI-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |