C14H21F3N4O3 — CID 55720354
3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]propanamide (PubChem CID 55720354) has the molecular formula C14H21F3N4O3 and a molecular weight of 350.34 g/mol. Its IUPAC name is 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]propanamide.
| Compound Name | 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]propanamide |
|---|---|
| PubChem CID | 55720354 |
| Molecular Formula | C14H21F3N4O3 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]propanamide |
| SMILES | Cc1[nH]c(=O)[nH]c(=O)c1CCC(=O)NCCCN(C)CC(F)(F)F |
| InChI | InChI=1S/C14H21F3N4O3/c1-9-10(12(23)20-13(24)19-9)4-5-11(22)18-6-3-7-21(2)8-14(15,16)17/h3-8H2,1-2H3,(H,18,22)(H2,19,20,23,24) |
| InChIKey | IWKDMRZLENAMBD-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 98.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|