C20H23F3N4O2 — CID 55721991
N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 55721991) has the molecular formula C20H23F3N4O2 and a molecular weight of 408.42 g/mol. Its IUPAC name is N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55721991 |
| Molecular Formula | C20H23F3N4O2 |
| Molecular Weight | 408.42 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | N-[3-(3-methyl-1-phenylpyrazol-4-yl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | Cc1nn(-c2ccccc2)cc1CCCNC(=O)C1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C20H23F3N4O2/c1-14-15(12-27(25-14)17-7-3-2-4-8-17)6-5-9-24-19(29)16-10-18(28)26(11-16)13-20(21,22)23/h2-4,7-8,12,16H,5-6,9-11,13H2,1H3,(H,24,29) |
| InChIKey | LPIZJVHTOQPRTL-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|