C16H18F4N2O2 — CID 95234126
(3R)-N-[3-(3-fluorophenyl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide (PubChem CID 95234126) has the molecular formula C16H18F4N2O2 and a molecular weight of 346.32 g/mol. Its IUPAC name is (3R)-N-[3-(3-fluorophenyl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide.
| Compound Name | (3R)-N-[3-(3-fluorophenyl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 95234126 |
| Molecular Formula | C16H18F4N2O2 |
| Molecular Weight | 346.32 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3R)-N-[3-(3-fluorophenyl)propyl]-5-oxo-1-(2,2,2-trifluoroethyl)pyrrolidine-3-carboxamide |
| SMILES | O=C(NCCCc1cccc(F)c1)[C@@H]1CC(=O)N(CC(F)(F)F)C1 |
| InChI | InChI=1S/C16H18F4N2O2/c17-13-5-1-3-11(7-13)4-2-6-21-15(24)12-8-14(23)22(9-12)10-16(18,19)20/h1,3,5,7,12H,2,4,6,8-10H2,(H,21,24)/t12-/m1/s1 |
| InChIKey | BTWPTDOUFXXBLS-GFCCVEGCSA-N |
| XLogP | 2.29 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|