C23H24N4O2 — CID 55726221
N-[2-(N-methylanilino)phenyl]-3-(phenylcarbamoylamino)propanamide (PubChem CID 55726221) has the molecular formula C23H24N4O2 and a molecular weight of 388.47 g/mol. Its IUPAC name is N-[2-(N-methylanilino)phenyl]-3-(phenylcarbamoylamino)propanamide.
| Compound Name | N-[2-(N-methylanilino)phenyl]-3-(phenylcarbamoylamino)propanamide |
|---|---|
| PubChem CID | 55726221 |
| Molecular Formula | C23H24N4O2 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | N-[2-(N-methylanilino)phenyl]-3-(phenylcarbamoylamino)propanamide |
| SMILES | CN(c1ccccc1)c1ccccc1NC(=O)CCNC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C23H24N4O2/c1-27(19-12-6-3-7-13-19)21-15-9-8-14-20(21)26-22(28)16-17-24-23(29)25-18-10-4-2-5-11-18/h2-15H,16-17H2,1H3,(H,26,28)(H2,24,25,29) |
| InChIKey | XIBBVWWUBGBMNZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 73.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |