C21H25N5O3S — CID 55729115
N-[1-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide (PubChem CID 55729115) has the molecular formula C21H25N5O3S and a molecular weight of 427.53 g/mol. Its IUPAC name is N-[1-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide.
| Compound Name | N-[1-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 55729115 |
| Molecular Formula | C21H25N5O3S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.17 |
| IUPAC Name | N-[1-[2-[(3-cyano-2-pyridinyl)amino]ethylamino]-4-methylsulfanyl-1-oxobutan-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NC(CCSC)C(=O)NCCNc1ncccc1C#N |
| InChI | InChI=1S/C21H25N5O3S/c1-29-18-8-4-3-7-16(18)20(27)26-17(9-13-30-2)21(28)25-12-11-24-19-15(14-22)6-5-10-23-19/h3-8,10,17H,9,11-13H2,1-2H3,(H,23,24)(H,25,28)(H,26,27) |
| InChIKey | PZMFAUFHGVUFMF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 116.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|