C21H29FN2O3 — CID 55731272
1-(cyclohexanecarbonyl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylpyrrolidine-2-carboxamide (PubChem CID 55731272) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is 1-(cyclohexanecarbonyl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylpyrrolidine-2-carboxamide.
| Compound Name | 1-(cyclohexanecarbonyl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 55731272 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 1-(cyclohexanecarbonyl)-N-[2-(4-fluorophenoxy)ethyl]-N-methylpyrrolidine-2-carboxamide |
| SMILES | CN(CCOc1ccc(F)cc1)C(=O)C1CCCN1C(=O)C1CCCCC1 |
| InChI | InChI=1S/C21H29FN2O3/c1-23(14-15-27-18-11-9-17(22)10-12-18)21(26)19-8-5-13-24(19)20(25)16-6-3-2-4-7-16/h9-12,16,19H,2-8,13-15H2,1H3 |
| InChIKey | RFMZZCNEDZNCMR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |