C18H18N4O3S — CID 55731494
N-[4-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-4-oxobutyl]thiophene-2-carboxamide (PubChem CID 55731494) has the molecular formula C18H18N4O3S and a molecular weight of 370.43 g/mol. Its IUPAC name is N-[4-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-4-oxobutyl]thiophene-2-carboxamide.
| Compound Name | N-[4-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-4-oxobutyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55731494 |
| Molecular Formula | C18H18N4O3S |
| Molecular Weight | 370.43 g/mol |
| Exact Mass | 370.11 |
| IUPAC Name | N-[4-[2-methyl-5-(1,3,4-oxadiazol-2-yl)anilino]-4-oxobutyl]thiophene-2-carboxamide |
| SMILES | Cc1ccc(-c2nnco2)cc1NC(=O)CCCNC(=O)c1cccs1 |
| InChI | InChI=1S/C18H18N4O3S/c1-12-6-7-13(18-22-20-11-25-18)10-14(12)21-16(23)5-2-8-19-17(24)15-4-3-9-26-15/h3-4,6-7,9-11H,2,5,8H2,1H3,(H,19,24)(H,21,23) |
| InChIKey | IZHRTPVCCAHWLR-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|