C24H18N4O3 — CID 55731779
N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide (PubChem CID 55731779) has the molecular formula C24H18N4O3 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide.
| Compound Name | N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide |
|---|---|
| PubChem CID | 55731779 |
| Molecular Formula | C24H18N4O3 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | N-[2-methyl-5-(1,3,4-oxadiazol-2-yl)phenyl]-2-(9-oxoacridin-10-yl)acetamide |
| SMILES | Cc1ccc(-c2nnco2)cc1NC(=O)Cn1c2ccccc2c(=O)c2ccccc21 |
| InChI | InChI=1S/C24H18N4O3/c1-15-10-11-16(24-27-25-14-31-24)12-19(15)26-22(29)13-28-20-8-4-2-6-17(20)23(30)18-7-3-5-9-21(18)28/h2-12,14H,13H2,1H3,(H,26,29) |
| InChIKey | MRXCMBAMGCGWJU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 90.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|