C24H22FN3O3S — CID 55732537
N-(4-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butanamide (PubChem CID 55732537) has the molecular formula C24H22FN3O3S and a molecular weight of 451.52 g/mol. Its IUPAC name is N-(4-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butanamide.
| Compound Name | N-(4-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butanamide |
|---|---|
| PubChem CID | 55732537 |
| Molecular Formula | C24H22FN3O3S |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | N-(4-fluorophenyl)-4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[(2-methyl-1,3-thiazol-4-yl)methyl]butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)N(Cc1csc(C)n1)c1ccc(F)cc1)C2=O |
| InChI | InChI=1S/C24H22FN3O3S/c1-15-5-10-20-21(12-15)24(31)27(23(20)30)11-3-4-22(29)28(13-18-14-32-16(2)26-18)19-8-6-17(25)7-9-19/h5-10,12,14H,3-4,11,13H2,1-2H3 |
| InChIKey | WHIGYQFRXDJDGI-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|