C15H15BrN2O5S — CID 55734307
N-[2-[2-(benzenesulfonyl)ethylamino]-2-oxoethyl]-5-bromofuran-2-carboxamide (PubChem CID 55734307) has the molecular formula C15H15BrN2O5S and a molecular weight of 415.27 g/mol. Its IUPAC name is N-[2-[2-(benzenesulfonyl)ethylamino]-2-oxoethyl]-5-bromofuran-2-carboxamide.
| Compound Name | N-[2-[2-(benzenesulfonyl)ethylamino]-2-oxoethyl]-5-bromofuran-2-carboxamide |
|---|---|
| PubChem CID | 55734307 |
| Molecular Formula | C15H15BrN2O5S |
| Molecular Weight | 415.27 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | N-[2-[2-(benzenesulfonyl)ethylamino]-2-oxoethyl]-5-bromofuran-2-carboxamide |
| SMILES | O=C(CNC(=O)c1ccc(Br)o1)NCCS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H15BrN2O5S/c16-13-7-6-12(23-13)15(20)18-10-14(19)17-8-9-24(21,22)11-4-2-1-3-5-11/h1-7H,8-10H2,(H,17,19)(H,18,20) |
| InChIKey | ACIYQLUAOKXYLU-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |