C25H32FN3O2 — CID 55739345
N-[2-(N-ethyl-3-methylanilino)ethyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide (PubChem CID 55739345) has the molecular formula C25H32FN3O2 and a molecular weight of 425.55 g/mol. Its IUPAC name is N-[2-(N-ethyl-3-methylanilino)ethyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide.
| Compound Name | N-[2-(N-ethyl-3-methylanilino)ethyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55739345 |
| Molecular Formula | C25H32FN3O2 |
| Molecular Weight | 425.55 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | N-[2-(N-ethyl-3-methylanilino)ethyl]-1-[2-(4-fluorophenyl)acetyl]piperidine-3-carboxamide |
| SMILES | CCN(CCNC(=O)C1CCCN(C(=O)Cc2ccc(F)cc2)C1)c1cccc(C)c1 |
| InChI | InChI=1S/C25H32FN3O2/c1-3-28(23-8-4-6-19(2)16-23)15-13-27-25(31)21-7-5-14-29(18-21)24(30)17-20-9-11-22(26)12-10-20/h4,6,8-12,16,21H,3,5,7,13-15,17-18H2,1-2H3,(H,27,31) |
| InChIKey | GVNPAHTUZXFGQD-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.55 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |