C18H16ClFN2O3 — CID 55739493
[2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-pyridin-2-ylprop-2-enoate (PubChem CID 55739493) has the molecular formula C18H16ClFN2O3 and a molecular weight of 362.79 g/mol. Its IUPAC name is [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-pyridin-2-ylprop-2-enoate.
| Compound Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-pyridin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 55739493 |
| Molecular Formula | C18H16ClFN2O3 |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | [2-[(2-chloro-6-fluorophenyl)methyl-methylamino]-2-oxoethyl] 3-pyridin-2-ylprop-2-enoate |
| SMILES | CN(Cc1c(F)cccc1Cl)C(=O)COC(=O)C=Cc1ccccn1 |
| InChI | InChI=1S/C18H16ClFN2O3/c1-22(11-14-15(19)6-4-7-16(14)20)17(23)12-25-18(24)9-8-13-5-2-3-10-21-13/h2-10H,11-12H2,1H3 |
| InChIKey | SRCCCKZUVJJWFG-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|