C16H20ClN3O2 — CID 55743110
N-[2-(3-chlorophenoxy)ethyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide (PubChem CID 55743110) has the molecular formula C16H20ClN3O2 and a molecular weight of 321.81 g/mol. Its IUPAC name is N-[2-(3-chlorophenoxy)ethyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-[2-(3-chlorophenoxy)ethyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 55743110 |
| Molecular Formula | C16H20ClN3O2 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[2-(3-chlorophenoxy)ethyl]-5-(2-methylpropyl)-1H-pyrazole-3-carboxamide |
| SMILES | CC(C)Cc1cc(C(=O)NCCOc2cccc(Cl)c2)n[nH]1 |
| InChI | InChI=1S/C16H20ClN3O2/c1-11(2)8-13-10-15(20-19-13)16(21)18-6-7-22-14-5-3-4-12(17)9-14/h3-5,9-11H,6-8H2,1-2H3,(H,18,21)(H,19,20) |
| InChIKey | DYUUUYOPPARBQB-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|