C24H30N4O4 — CID 55743164
N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide (PubChem CID 55743164) has the molecular formula C24H30N4O4 and a molecular weight of 438.53 g/mol. Its IUPAC name is N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide.
| Compound Name | N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55743164 |
| Molecular Formula | C24H30N4O4 |
| Molecular Weight | 438.53 g/mol |
| Exact Mass | 438.23 |
| IUPAC Name | N-[4-methoxy-3-(2-oxopiperidin-1-yl)phenyl]-4-(4-methoxyphenyl)piperazine-1-carboxamide |
| SMILES | COc1ccc(N2CCN(C(=O)Nc3ccc(OC)c(N4CCCCC4=O)c3)CC2)cc1 |
| InChI | InChI=1S/C24H30N4O4/c1-31-20-9-7-19(8-10-20)26-13-15-27(16-14-26)24(30)25-18-6-11-22(32-2)21(17-18)28-12-4-3-5-23(28)29/h6-11,17H,3-5,12-16H2,1-2H3,(H,25,30) |
| InChIKey | LBVJTAPLPDMWMA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.53 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|