C21H25ClIN3O — CID 55743560
5-chloro-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-iodobenzamide (PubChem CID 55743560) has the molecular formula C21H25ClIN3O and a molecular weight of 497.81 g/mol. Its IUPAC name is 5-chloro-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-iodobenzamide.
| Compound Name | 5-chloro-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-iodobenzamide |
|---|---|
| PubChem CID | 55743560 |
| Molecular Formula | C21H25ClIN3O |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | 5-chloro-N-[[2-[(4-ethylpiperazin-1-yl)methyl]phenyl]methyl]-2-iodobenzamide |
| SMILES | CCN1CCN(Cc2ccccc2CNC(=O)c2cc(Cl)ccc2I)CC1 |
| InChI | InChI=1S/C21H25ClIN3O/c1-2-25-9-11-26(12-10-25)15-17-6-4-3-5-16(17)14-24-21(27)19-13-18(22)7-8-20(19)23/h3-8,13H,2,9-12,14-15H2,1H3,(H,24,27) |
| InChIKey | IDTPLZZBXCYYQC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|