C23H32N4O4S — CID 55746394
4-[[2-[(2,5-dimethylphenyl)sulfonylamino]ethylcarbamoylamino]methyl]-N-methyl-N-propan-2-ylbenzamide (PubChem CID 55746394) has the molecular formula C23H32N4O4S and a molecular weight of 460.60 g/mol. Its IUPAC name is 4-[[2-[(2,5-dimethylphenyl)sulfonylamino]ethylcarbamoylamino]methyl]-N-methyl-N-propan-2-ylbenzamide.
| Compound Name | 4-[[2-[(2,5-dimethylphenyl)sulfonylamino]ethylcarbamoylamino]methyl]-N-methyl-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 55746394 |
| Molecular Formula | C23H32N4O4S |
| Molecular Weight | 460.60 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | 4-[[2-[(2,5-dimethylphenyl)sulfonylamino]ethylcarbamoylamino]methyl]-N-methyl-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)NCCNC(=O)NCc2ccc(C(=O)N(C)C(C)C)cc2)c1 |
| InChI | InChI=1S/C23H32N4O4S/c1-16(2)27(5)22(28)20-10-8-19(9-11-20)15-25-23(29)24-12-13-26-32(30,31)21-14-17(3)6-7-18(21)4/h6-11,14,16,26H,12-13,15H2,1-5H3,(H2,24,25,29) |
| InChIKey | RUWSBVSXNNDVLL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.60 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|