About cyclopent-3-ene-1,2-diol
cyclopent-3-ene-1,2-diol (PubChem CID 557495) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is cyclopent-3-ene-1,2-diol.
Molecular Properties
| Compound Name | cyclopent-3-ene-1,2-diol |
| PubChem CID | 557495 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | cyclopent-3-ene-1,2-diol |
| SMILES | OC1C=CCC1O |
| InChI | InChI=1S/C5H8O2/c6-4-2-1-3-5(4)7/h1-2,4-7H,3H2 |
| InChIKey | VQWAZBMRMSMLPG-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopent-3-ene-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopent-3-ene-1,2-diol?
The IUPAC name of cyclopent-3-ene-1,2-diol (CID 557495) is cyclopent-3-ene-1,2-diol.
What is the SMILES notation for cyclopent-3-ene-1,2-diol?
The canonical SMILES for cyclopent-3-ene-1,2-diol is OC1C=CCC1O.
What is the InChIKey of cyclopent-3-ene-1,2-diol?
The InChIKey is VQWAZBMRMSMLPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2/c6-4-2-1-3-5(4)7/h1-2,4-7H,3H2.
What are the key properties of cyclopent-3-ene-1,2-diol?
cyclopent-3-ene-1,2-diol has a molecular weight of 100.12 g/mol, XLogP of -0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopent-3-ene-1,2-diol is sourced from PubChem (CID 557495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).