C19H15Cl2NO2S2 — CID 55750496
N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide (PubChem CID 55750496) has the molecular formula C19H15Cl2NO2S2 and a molecular weight of 424.37 g/mol. Its IUPAC name is N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide.
| Compound Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide |
|---|---|
| PubChem CID | 55750496 |
| Molecular Formula | C19H15Cl2NO2S2 |
| Molecular Weight | 424.37 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | N-[(4-chlorophenyl)-thiophen-2-ylmethyl]-4-(5-chlorothiophen-2-yl)-4-oxobutanamide |
| SMILES | O=C(CCC(=O)c1ccc(Cl)s1)NC(c1ccc(Cl)cc1)c1cccs1 |
| InChI | InChI=1S/C19H15Cl2NO2S2/c20-13-5-3-12(4-6-13)19(16-2-1-11-25-16)22-18(24)10-7-14(23)15-8-9-17(21)26-15/h1-6,8-9,11,19H,7,10H2,(H,22,24) |
| InChIKey | IAKDFTDDCMGHMO-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.37 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |