C24H28N4O5S — CID 55750710
[4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate (PubChem CID 55750710) has the molecular formula C24H28N4O5S and a molecular weight of 484.58 g/mol. Its IUPAC name is [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate.
| Compound Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
|---|---|
| PubChem CID | 55750710 |
| Molecular Formula | C24H28N4O5S |
| Molecular Weight | 484.58 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | [4-[methyl(propan-2-ylcarbamoyl)amino]phenyl] 3-(3-methoxypropyl)-4-oxo-2-sulfanylidene-1H-quinazoline-7-carboxylate |
| SMILES | COCCCn1c(=S)[nH]c2cc(C(=O)Oc3ccc(N(C)C(=O)NC(C)C)cc3)ccc2c1=O |
| InChI | InChI=1S/C24H28N4O5S/c1-15(2)25-23(31)27(3)17-7-9-18(10-8-17)33-22(30)16-6-11-19-20(14-16)26-24(34)28(21(19)29)12-5-13-32-4/h6-11,14-15H,5,12-13H2,1-4H3,(H,25,31)(H,26,34) |
| InChIKey | QHGOIQJMUJUMFI-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 105.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|