C26H24F3N3O3 — CID 55754408
[3-(benzylcarbamoyl)phenyl] 1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylate (PubChem CID 55754408) has the molecular formula C26H24F3N3O3 and a molecular weight of 483.49 g/mol. Its IUPAC name is [3-(benzylcarbamoyl)phenyl] 1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylate.
| Compound Name | [3-(benzylcarbamoyl)phenyl] 1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylate |
|---|---|
| PubChem CID | 55754408 |
| Molecular Formula | C26H24F3N3O3 |
| Molecular Weight | 483.49 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | [3-(benzylcarbamoyl)phenyl] 1-[3-(trifluoromethyl)-2-pyridinyl]piperidine-3-carboxylate |
| SMILES | O=C(NCc1ccccc1)c1cccc(OC(=O)C2CCCN(c3ncccc3C(F)(F)F)C2)c1 |
| InChI | InChI=1S/C26H24F3N3O3/c27-26(28,29)22-12-5-13-30-23(22)32-14-6-10-20(17-32)25(34)35-21-11-4-9-19(15-21)24(33)31-16-18-7-2-1-3-8-18/h1-5,7-9,11-13,15,20H,6,10,14,16-17H2,(H,31,33) |
| InChIKey | UOLMBCBFWXQMEA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.49 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|