C18H23F2N3O4S — CID 55760614
N-[2-(difluoromethylsulfonyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide (PubChem CID 55760614) has the molecular formula C18H23F2N3O4S and a molecular weight of 415.46 g/mol. Its IUPAC name is N-[2-(difluoromethylsulfonyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(difluoromethylsulfonyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55760614 |
| Molecular Formula | C18H23F2N3O4S |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | N-[2-(difluoromethylsulfonyl)phenyl]-1-(pyrrolidine-1-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccccc1S(=O)(=O)C(F)F)C1CCN(C(=O)N2CCCC2)CC1 |
| InChI | InChI=1S/C18H23F2N3O4S/c19-17(20)28(26,27)15-6-2-1-5-14(15)21-16(24)13-7-11-23(12-8-13)18(25)22-9-3-4-10-22/h1-2,5-6,13,17H,3-4,7-12H2,(H,21,24) |
| InChIKey | CXNVYJSLILZPLZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |