C19H22N6O4 — CID 55760816
2-methoxyethyl 2,4-dimethyl-5-[[4-methyl-3-(tetrazol-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate (PubChem CID 55760816) has the molecular formula C19H22N6O4 and a molecular weight of 398.42 g/mol. Its IUPAC name is 2-methoxyethyl 2,4-dimethyl-5-[[4-methyl-3-(tetrazol-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate.
| Compound Name | 2-methoxyethyl 2,4-dimethyl-5-[[4-methyl-3-(tetrazol-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 55760816 |
| Molecular Formula | C19H22N6O4 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 2-methoxyethyl 2,4-dimethyl-5-[[4-methyl-3-(tetrazol-1-yl)phenyl]carbamoyl]-1H-pyrrole-3-carboxylate |
| SMILES | COCCOC(=O)c1c(C)[nH]c(C(=O)Nc2ccc(C)c(-n3cnnn3)c2)c1C |
| InChI | InChI=1S/C19H22N6O4/c1-11-5-6-14(9-15(11)25-10-20-23-24-25)22-18(26)17-12(2)16(13(3)21-17)19(27)29-8-7-28-4/h5-6,9-10,21H,7-8H2,1-4H3,(H,22,26) |
| InChIKey | SYJGOSAKMMVUFD-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|