C18H27N3O4S — CID 55768153
3-(dimethylsulfamoyl)-N-[1-(ethylcarbamoyl)cyclohexyl]benzamide (PubChem CID 55768153) has the molecular formula C18H27N3O4S and a molecular weight of 381.50 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[1-(ethylcarbamoyl)cyclohexyl]benzamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[1-(ethylcarbamoyl)cyclohexyl]benzamide |
|---|---|
| PubChem CID | 55768153 |
| Molecular Formula | C18H27N3O4S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[1-(ethylcarbamoyl)cyclohexyl]benzamide |
| SMILES | CCNC(=O)C1(NC(=O)c2cccc(S(=O)(=O)N(C)C)c2)CCCCC1 |
| InChI | InChI=1S/C18H27N3O4S/c1-4-19-17(23)18(11-6-5-7-12-18)20-16(22)14-9-8-10-15(13-14)26(24,25)21(2)3/h8-10,13H,4-7,11-12H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | SXMJVULQFVPURU-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |