C22H25N3O7S — CID 55967538
[4-[[1-(ethylcarbamoyl)cyclohexyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate (PubChem CID 55967538) has the molecular formula C22H25N3O7S and a molecular weight of 475.52 g/mol. Its IUPAC name is [4-[[1-(ethylcarbamoyl)cyclohexyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate.
| Compound Name | [4-[[1-(ethylcarbamoyl)cyclohexyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 55967538 |
| Molecular Formula | C22H25N3O7S |
| Molecular Weight | 475.52 g/mol |
| Exact Mass | 475.14 |
| IUPAC Name | [4-[[1-(ethylcarbamoyl)cyclohexyl]carbamoyl]phenyl] 3-nitrobenzenesulfonate |
| SMILES | CCNC(=O)C1(NC(=O)c2ccc(OS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)CCCCC1 |
| InChI | InChI=1S/C22H25N3O7S/c1-2-23-21(27)22(13-4-3-5-14-22)24-20(26)16-9-11-18(12-10-16)32-33(30,31)19-8-6-7-17(15-19)25(28)29/h6-12,15H,2-5,13-14H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | KUNSDTNLYTTZJS-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 144.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|