C22H25N3O5S — CID 55768874
2-butyl-N-[1-[2-(methanesulfonamido)phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide (PubChem CID 55768874) has the molecular formula C22H25N3O5S and a molecular weight of 443.53 g/mol. Its IUPAC name is 2-butyl-N-[1-[2-(methanesulfonamido)phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide.
| Compound Name | 2-butyl-N-[1-[2-(methanesulfonamido)phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
|---|---|
| PubChem CID | 55768874 |
| Molecular Formula | C22H25N3O5S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 2-butyl-N-[1-[2-(methanesulfonamido)phenyl]ethyl]-1,3-dioxoisoindole-5-carboxamide |
| SMILES | CCCCN1C(=O)c2ccc(C(=O)NC(C)c3ccccc3NS(C)(=O)=O)cc2C1=O |
| InChI | InChI=1S/C22H25N3O5S/c1-4-5-12-25-21(27)17-11-10-15(13-18(17)22(25)28)20(26)23-14(2)16-8-6-7-9-19(16)24-31(3,29)30/h6-11,13-14,24H,4-5,12H2,1-3H3,(H,23,26) |
| InChIKey | ZOOCCYWVLNLJNX-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|