C15H14ClIN2O3S — CID 55771427
N-(4-chlorophenyl)-5-(dimethylsulfamoyl)-2-iodobenzamide (PubChem CID 55771427) has the molecular formula C15H14ClIN2O3S and a molecular weight of 464.71 g/mol. Its IUPAC name is N-(4-chlorophenyl)-5-(dimethylsulfamoyl)-2-iodobenzamide.
| Compound Name | N-(4-chlorophenyl)-5-(dimethylsulfamoyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 55771427 |
| Molecular Formula | C15H14ClIN2O3S |
| Molecular Weight | 464.71 g/mol |
| Exact Mass | 463.95 |
| IUPAC Name | N-(4-chlorophenyl)-5-(dimethylsulfamoyl)-2-iodobenzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(I)c(C(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C15H14ClIN2O3S/c1-19(2)23(21,22)12-7-8-14(17)13(9-12)15(20)18-11-5-3-10(16)4-6-11/h3-9H,1-2H3,(H,18,20) |
| InChIKey | SCWFMQRLDZMJLH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.71 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|