C12H14BrIN2O3S — CID 47438537
N-(2-bromoprop-2-enyl)-5-(dimethylsulfamoyl)-2-iodobenzamide (PubChem CID 47438537) has the molecular formula C12H14BrIN2O3S and a molecular weight of 473.13 g/mol. Its IUPAC name is N-(2-bromoprop-2-enyl)-5-(dimethylsulfamoyl)-2-iodobenzamide.
| Compound Name | N-(2-bromoprop-2-enyl)-5-(dimethylsulfamoyl)-2-iodobenzamide |
|---|---|
| PubChem CID | 47438537 |
| Molecular Formula | C12H14BrIN2O3S |
| Molecular Weight | 473.13 g/mol |
| Exact Mass | 471.90 |
| IUPAC Name | N-(2-bromoprop-2-enyl)-5-(dimethylsulfamoyl)-2-iodobenzamide |
| SMILES | C=C(Br)CNC(=O)c1cc(S(=O)(=O)N(C)C)ccc1I |
| InChI | InChI=1S/C12H14BrIN2O3S/c1-8(13)7-15-12(17)10-6-9(4-5-11(10)14)20(18,19)16(2)3/h4-6H,1,7H2,2-3H3,(H,15,17) |
| InChIKey | WBPZXQPWZBMSET-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.13 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|