C25H26ClN3O2 — CID 55774411
[4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone (PubChem CID 55774411) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is [4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone.
| Compound Name | [4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone |
|---|---|
| PubChem CID | 55774411 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | [4-[1-(2-chlorophenyl)ethyl]piperazin-1-yl]-[3-(pyridin-3-ylmethoxy)phenyl]methanone |
| SMILES | CC(c1ccccc1Cl)N1CCN(C(=O)c2cccc(OCc3cccnc3)c2)CC1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-19(23-9-2-3-10-24(23)26)28-12-14-29(15-13-28)25(30)21-7-4-8-22(16-21)31-18-20-6-5-11-27-17-20/h2-11,16-17,19H,12-15,18H2,1H3 |
| InChIKey | JIIHYRWRGMDDLT-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |