C19H22N2O7S — CID 55776713
methyl 2-[4-[[2-(methanesulfonamido)phenyl]methylcarbamoyl]-2-methoxyphenoxy]acetate (PubChem CID 55776713) has the molecular formula C19H22N2O7S and a molecular weight of 422.46 g/mol. Its IUPAC name is methyl 2-[4-[[2-(methanesulfonamido)phenyl]methylcarbamoyl]-2-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(methanesulfonamido)phenyl]methylcarbamoyl]-2-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 55776713 |
| Molecular Formula | C19H22N2O7S |
| Molecular Weight | 422.46 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | methyl 2-[4-[[2-(methanesulfonamido)phenyl]methylcarbamoyl]-2-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1ccc(C(=O)NCc2ccccc2NS(C)(=O)=O)cc1OC |
| InChI | InChI=1S/C19H22N2O7S/c1-26-17-10-13(8-9-16(17)28-12-18(22)27-2)19(23)20-11-14-6-4-5-7-15(14)21-29(3,24)25/h4-10,21H,11-12H2,1-3H3,(H,20,23) |
| InChIKey | JHGIQTDUBMHLLR-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |