C24H27FN2O4 — CID 55776961
N-[5-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-fluorophenyl]cyclohexanecarboxamide (PubChem CID 55776961) has the molecular formula C24H27FN2O4 and a molecular weight of 426.49 g/mol. Its IUPAC name is N-[5-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-fluorophenyl]cyclohexanecarboxamide.
| Compound Name | N-[5-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-fluorophenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 55776961 |
| Molecular Formula | C24H27FN2O4 |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.20 |
| IUPAC Name | N-[5-[[(E)-3-(3,5-dimethoxyphenyl)prop-2-enoyl]amino]-2-fluorophenyl]cyclohexanecarboxamide |
| SMILES | COc1cc(/C=C/C(=O)Nc2ccc(F)c(NC(=O)C3CCCCC3)c2)cc(OC)c1 |
| InChI | InChI=1S/C24H27FN2O4/c1-30-19-12-16(13-20(15-19)31-2)8-11-23(28)26-18-9-10-21(25)22(14-18)27-24(29)17-6-4-3-5-7-17/h8-15,17H,3-7H2,1-2H3,(H,26,28)(H,27,29)/b11-8+ |
| InChIKey | OTIPAEBMXSQNPB-DHZHZOJOSA-N |
| XLogP | 5.01 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|