About dicyclohexyl sulfite
dicyclohexyl sulfite (PubChem CID 557841) has the molecular formula C12H22O3S
and a molecular weight of 246.37 g/mol. Its IUPAC name is dicyclohexyl sulfite.
Molecular Properties
| Compound Name | dicyclohexyl sulfite |
| PubChem CID | 557841 |
| Molecular Formula | C12H22O3S |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | dicyclohexyl sulfite |
| SMILES | O=S(OC1CCCCC1)OC1CCCCC1 |
| InChI | InChI=1S/C12H22O3S/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2 |
| InChIKey | HCLXYOPDAYADQM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze dicyclohexyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dicyclohexyl sulfite?
The IUPAC name of dicyclohexyl sulfite (CID 557841) is dicyclohexyl sulfite.
What is the SMILES notation for dicyclohexyl sulfite?
The canonical SMILES for dicyclohexyl sulfite is O=S(OC1CCCCC1)OC1CCCCC1.
What is the InChIKey of dicyclohexyl sulfite?
The InChIKey is HCLXYOPDAYADQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O3S/c13-16(14-11-7-3-1-4-8-11)15-12-9-5-2-6-10-12/h11-12H,1-10H2.
What are the key properties of dicyclohexyl sulfite?
dicyclohexyl sulfite has a molecular weight of 246.37 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dicyclohexyl sulfite is sourced from PubChem (CID 557841), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).