C22H31NO5S — CID 90832383
cyclohexyl (10,12-dihydroxy-4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-dien-11-yl) sulfite (PubChem CID 90832383) has the molecular formula C22H31NO5S and a molecular weight of 421.56 g/mol. Its IUPAC name is cyclohexyl (10,12-dihydroxy-4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-dien-11-yl) sulfite.
| Compound Name | cyclohexyl (10,12-dihydroxy-4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-dien-11-yl) sulfite |
|---|---|
| PubChem CID | 90832383 |
| Molecular Formula | C22H31NO5S |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | cyclohexyl (10,12-dihydroxy-4,5-dimethyl-11-azapentacyclo[6.5.1.13,6.02,7.09,13]pentadeca-9,12-dien-11-yl) sulfite |
| SMILES | CC1C(C)C2CC1C1C3CC(c4c3c(O)n(OS(=O)OC3CCCCC3)c4O)C21 |
| InChI | InChI=1S/C22H31NO5S/c1-10-11(2)14-8-13(10)17-15-9-16(18(14)17)20-19(15)21(24)23(22(20)25)28-29(26)27-12-6-4-3-5-7-12/h10-18,24-25H,3-9H2,1-2H3 |
| InChIKey | RPWDYZHXLKMJJU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|