About cyclohexyloxysulfinyl cyclohexanesulfinate
cyclohexyloxysulfinyl cyclohexanesulfinate (PubChem CID 22974433) has the molecular formula C12H22O4S2
and a molecular weight of 294.44 g/mol. Its IUPAC name is cyclohexyloxysulfinyl cyclohexanesulfinate.
Molecular Properties
| Compound Name | cyclohexyloxysulfinyl cyclohexanesulfinate |
| PubChem CID | 22974433 |
| Molecular Formula | C12H22O4S2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | cyclohexyloxysulfinyl cyclohexanesulfinate |
| SMILES | O=S(OC1CCCCC1)OS(=O)C1CCCCC1 |
| InChI | InChI=1S/C12H22O4S2/c13-17(12-9-5-2-6-10-12)16-18(14)15-11-7-3-1-4-8-11/h11-12H,1-10H2 |
| InChIKey | KPUQMLOXKWLYQE-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclohexyloxysulfinyl cyclohexanesulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyloxysulfinyl cyclohexanesulfinate?
The IUPAC name of cyclohexyloxysulfinyl cyclohexanesulfinate (CID 22974433) is cyclohexyloxysulfinyl cyclohexanesulfinate.
What is the SMILES notation for cyclohexyloxysulfinyl cyclohexanesulfinate?
The canonical SMILES for cyclohexyloxysulfinyl cyclohexanesulfinate is O=S(OC1CCCCC1)OS(=O)C1CCCCC1.
What is the InChIKey of cyclohexyloxysulfinyl cyclohexanesulfinate?
The InChIKey is KPUQMLOXKWLYQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O4S2/c13-17(12-9-5-2-6-10-12)16-18(14)15-11-7-3-1-4-8-11/h11-12H,1-10H2.
What are the key properties of cyclohexyloxysulfinyl cyclohexanesulfinate?
cyclohexyloxysulfinyl cyclohexanesulfinate has a molecular weight of 294.44 g/mol, XLogP of 2.93, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyloxysulfinyl cyclohexanesulfinate is sourced from PubChem (CID 22974433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).